CAS No: 170917-89-2, Chemical Name: 2-benzyl 4a-methyl 7-chloroindeno[1,2-e][1,3,4]oxadiazine-2,4a(3H,5H)-dicarboxylate
the physical and chemical property of 170917-89-2, 2-benzyl 4a-methyl 7-chloroindeno[1,2-e][1,3,4]oxadiazine-2,4a(3H,5H)-dicarboxylate is provided by ChemNet.com
ChemNet > CAS > 170917-89-2 2-benzyl 4a-methyl 7-chloroindeno[1,2-e][1,3,4]oxadiazine-2,4a(3H,5H)-dicarboxylate
170917-89-2 2-benzyl 4a-methyl 7-chloroindeno[1,2-e][1,3,4]oxadiazine-2,4a(3H,5H)-dicarboxylate
상품명칭 |
2-benzyl 4a-methyl 7-chloroindeno[1,2-e][1,3,4]oxadiazine-2,4a(3H,5H)-dicarboxylate |
별명 |
7-Chloro-5H-indeno[1,2-e][1,3,4]oxadiazine-2,4a-dicarboxylic acid 2-benzyl ester 4a-Methyl ester; 7-Chloroindeno[1,2-E][1,3,4]Oxadiazine-2,4A(3H,5H)-Dicarboxylic Acid 4A-Methyl 2-Benzyl Ester |
분자식 |
C20H17ClN2O5 |
분자량 |
400.8124 |
InChI |
InChI=1/C20H17ClN2O5/c1-26-18(24)20-10-14-9-15(21)7-8-16(14)17(20)22-23(12-28-20)19(25)27-11-13-5-3-2-4-6-13/h2-9H,10-12H2,1H3 |
cas번호 |
170917-89-2 |
분자 구조 |
|
밀도 |
1.413g/cm3 |
비등점 |
531.734°C at 760 mmHg |
굴절 지수 |
1.641 |
인화점 |
275.383°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
|
|